C27H38N4O3 — CID 23601984
N-[[4-(dimethylamino)phenyl]methyl]-4-[[[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]amino]methyl]cyclohexane-1-carboxamide (PubChem CID 23601984) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-4-[[[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]amino]methyl]cyclohexane-1-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-4-[[[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]amino]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 23601984 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-4-[[[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]amino]methyl]cyclohexane-1-carboxamide |
| SMILES | CC1CCN(c2c(NCC3CCC(C(=O)NCc4ccc(N(C)C)cc4)CC3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C27H38N4O3/c1-18-12-14-31(15-13-18)24-23(25(32)26(24)33)28-16-19-4-8-21(9-5-19)27(34)29-17-20-6-10-22(11-7-20)30(2)3/h6-7,10-11,18-19,21,28H,4-5,8-9,12-17H2,1-3H3,(H,29,34) |
| InChIKey | RWKRFLVLWQPPKM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|