C23H32N6O2 — CID 53165860
N-[[4-(dimethylamino)phenyl]methyl]-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide (PubChem CID 53165860) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53165860 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C2CCN(c3cncnc3N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C23H32N6O2/c1-27(2)20-5-3-18(4-6-20)15-25-23(30)19-7-9-28(10-8-19)21-16-24-17-26-22(21)29-11-13-31-14-12-29/h3-6,16-17,19H,7-15H2,1-2H3,(H,25,30) |
| InChIKey | CJXHAAOZBPGLMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|