C21H26FN5O2 — CID 53165791
N-(4-fluoro-2-methylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide (PubChem CID 53165791) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53165791 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)C1CCN(c2cncnc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C21H26FN5O2/c1-15-12-17(22)2-3-18(15)25-21(28)16-4-6-26(7-5-16)19-13-23-14-24-20(19)27-8-10-29-11-9-27/h2-3,12-14,16H,4-11H2,1H3,(H,25,28) |
| InChIKey | MHKRYBJCDMJMFF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |