C21H27N5O2S — CID 53165812
N-(4-methylsulfanylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide (PubChem CID 53165812) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53165812 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-1-(4-morpholin-4-ylpyrimidin-5-yl)piperidine-4-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCN(c3cncnc3N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C21H27N5O2S/c1-29-18-4-2-17(3-5-18)24-21(27)16-6-8-25(9-7-16)19-14-22-15-23-20(19)26-10-12-28-13-11-26/h2-5,14-16H,6-13H2,1H3,(H,24,27) |
| InChIKey | ZDRHZXHQOQZBFC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |