C20H32N6O2 — CID 53165758
(4-ethylpiperazin-1-yl)-[1-(4-morpholin-4-ylpyrimidin-5-yl)piperidin-4-yl]methanone (PubChem CID 53165758) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[1-(4-morpholin-4-ylpyrimidin-5-yl)piperidin-4-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[1-(4-morpholin-4-ylpyrimidin-5-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 53165758 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[1-(4-morpholin-4-ylpyrimidin-5-yl)piperidin-4-yl]methanone |
| SMILES | CCN1CCN(C(=O)C2CCN(c3cncnc3N3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C20H32N6O2/c1-2-23-7-9-26(10-8-23)20(27)17-3-5-24(6-4-17)18-15-21-16-22-19(18)25-11-13-28-14-12-25/h15-17H,2-14H2,1H3 |
| InChIKey | UVXWTRAZISAYAD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |