C15H24N6O — CID 140653092
[1-(5-aminopyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 140653092) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is [1-(5-aminopyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [1-(5-aminopyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 140653092 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [1-(5-aminopyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2CCN(c3ncncc3N)CC2)CC1 |
| InChI | InChI=1S/C15H24N6O/c1-19-6-8-21(9-7-19)15(22)12-2-4-20(5-3-12)14-13(16)10-17-11-18-14/h10-12H,2-9,16H2,1H3 |
| InChIKey | WDSNXSBMDMXAQM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |