C26H35N5O3 — CID 5309896
3-piperidin-1-yl-4-[[4-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohexyl]methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 5309896) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-piperidin-1-yl-4-[[4-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohexyl]methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-piperidin-1-yl-4-[[4-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohexyl]methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 5309896 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 3-piperidin-1-yl-4-[[4-(4-pyridin-2-ylpiperazine-1-carbonyl)cyclohexyl]methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=C(C1CCC(CNc2c(N3CCCCC3)c(=O)c2=O)CC1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C26H35N5O3/c32-24-22(23(25(24)33)30-12-4-1-5-13-30)28-18-19-7-9-20(10-8-19)26(34)31-16-14-29(15-17-31)21-6-2-3-11-27-21/h2-3,6,11,19-20,28H,1,4-5,7-10,12-18H2 |
| InChIKey | NOMBHUGVIVEAMT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|