C14H19N3O3S — CID 56809257
(1,1-dioxothiolan-3-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 56809257) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 56809257 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C14H19N3O3S/c18-14(12-4-10-21(19,20)11-12)17-8-6-16(7-9-17)13-3-1-2-5-15-13/h1-3,5,12H,4,6-11H2 |
| InChIKey | RPMXQSVJVSWONZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |