C25H30N4O3 — CID 42194632
cyclopropyl-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]methanone (PubChem CID 42194632) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is cyclopropyl-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42194632 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | cyclopropyl-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(OC2CCN(C(=O)C3CC3)CC2)cc1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C25H30N4O3/c30-24(19-4-5-19)28-13-10-22(11-14-28)32-21-8-6-20(7-9-21)25(31)29-17-15-27(16-18-29)23-3-1-2-12-26-23/h1-3,6-9,12,19,22H,4-5,10-11,13-18H2 |
| InChIKey | RVKVOMSJLUYJAG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |