C24H30N4O4 — CID 25280317
2-methoxy-1-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone (PubChem CID 25280317) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-methoxy-1-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 25280317 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-methoxy-1-[4-[4-(4-pyridin-2-ylpiperazine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCC(Oc2ccc(C(=O)N3CCN(c4ccccn4)CC3)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O4/c1-31-18-23(29)27-12-9-21(10-13-27)32-20-7-5-19(6-8-20)24(30)28-16-14-26(15-17-28)22-4-2-3-11-25-22/h2-8,11,21H,9-10,12-18H2,1H3 |
| InChIKey | ACGMUHTYUHNJGY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |