C15H21NO4 — CID 70724680
2-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]ethanone (PubChem CID 70724680) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70724680 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCC(Oc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C15H21NO4/c1-18-11-15(17)16-9-7-14(8-10-16)20-13-5-3-12(19-2)4-6-13/h3-6,14H,7-11H2,1-2H3 |
| InChIKey | GZFUMXCPGICQOB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |