C16H25ClN2O4 — CID 154897114
(2R)-2-amino-3-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 154897114) has the molecular formula C16H25ClN2O4 and a molecular weight of 344.84 g/mol. Its IUPAC name is (2R)-2-amino-3-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-3-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 154897114 |
| Molecular Formula | C16H25ClN2O4 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (2R)-2-amino-3-methoxy-1-[4-(4-methoxyphenoxy)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | COC[C@@H](N)C(=O)N1CCC(Oc2ccc(OC)cc2)CC1.Cl |
| InChI | InChI=1S/C16H24N2O4.ClH/c1-20-11-15(17)16(19)18-9-7-14(8-10-18)22-13-5-3-12(21-2)4-6-13;/h3-6,14-15H,7-11,17H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | HLKIQVCEEUSKNS-XFULWGLBSA-N |
| XLogP | 1.46 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |