About 1-(sulfanylmethyl)-1,3-diazinan-2-one
1-(sulfanylmethyl)-1,3-diazinan-2-one (PubChem CID 118952516) has the molecular formula C5H10N2OS
and a molecular weight of 146.22 g/mol. Its IUPAC name is 1-(sulfanylmethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(sulfanylmethyl)-1,3-diazinan-2-one |
| PubChem CID | 118952516 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1-(sulfanylmethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CS |
| InChI | InChI=1S/C5H10N2OS/c8-5-6-2-1-3-7(5)4-9/h9H,1-4H2,(H,6,8) |
| InChIKey | ZCGGOEQIFNRPQZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(sulfanylmethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(sulfanylmethyl)-1,3-diazinan-2-one?
The IUPAC name of 1-(sulfanylmethyl)-1,3-diazinan-2-one (CID 118952516) is 1-(sulfanylmethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(sulfanylmethyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(sulfanylmethyl)-1,3-diazinan-2-one is O=C1NCCCN1CS.
What is the InChIKey of 1-(sulfanylmethyl)-1,3-diazinan-2-one?
The InChIKey is ZCGGOEQIFNRPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2OS/c8-5-6-2-1-3-7(5)4-9/h9H,1-4H2,(H,6,8).
What are the key properties of 1-(sulfanylmethyl)-1,3-diazinan-2-one?
1-(sulfanylmethyl)-1,3-diazinan-2-one has a molecular weight of 146.22 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(sulfanylmethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 118952516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).