C5H10N2OS — CID 118952516
1-(sulfanylmethyl)-1,3-diazinan-2-one (PubChem CID 118952516) has the molecular formula C5H10N2OS and a molecular weight of 146.22 g/mol. Its IUPAC name is 1-(sulfanylmethyl)-1,3-diazinan-2-one.
| Compound Name | 1-(sulfanylmethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 118952516 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1-(sulfanylmethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CS |
| InChI | InChI=1S/C5H10N2OS/c8-5-6-2-1-3-7(5)4-9/h9H,1-4H2,(H,6,8) |
| InChIKey | ZCGGOEQIFNRPQZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|