About methyl 2-oxo-1,3-diazinane-1-carboxylate
methyl 2-oxo-1,3-diazinane-1-carboxylate (PubChem CID 154375641) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is methyl 2-oxo-1,3-diazinane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-oxo-1,3-diazinane-1-carboxylate |
| PubChem CID | 154375641 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | methyl 2-oxo-1,3-diazinane-1-carboxylate |
| SMILES | COC(=O)N1CCCNC1=O |
| InChI | InChI=1S/C6H10N2O3/c1-11-6(10)8-4-2-3-7-5(8)9/h2-4H2,1H3,(H,7,9) |
| InChIKey | IEGPPPRGTQMTSG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-oxo-1,3-diazinane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxo-1,3-diazinane-1-carboxylate?
The IUPAC name of methyl 2-oxo-1,3-diazinane-1-carboxylate (CID 154375641) is methyl 2-oxo-1,3-diazinane-1-carboxylate.
What is the SMILES notation for methyl 2-oxo-1,3-diazinane-1-carboxylate?
The canonical SMILES for methyl 2-oxo-1,3-diazinane-1-carboxylate is COC(=O)N1CCCNC1=O.
What is the InChIKey of methyl 2-oxo-1,3-diazinane-1-carboxylate?
The InChIKey is IEGPPPRGTQMTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-11-6(10)8-4-2-3-7-5(8)9/h2-4H2,1H3,(H,7,9).
What are the key properties of methyl 2-oxo-1,3-diazinane-1-carboxylate?
methyl 2-oxo-1,3-diazinane-1-carboxylate has a molecular weight of 158.16 g/mol, XLogP of 0.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-1,3-diazinane-1-carboxylate is sourced from PubChem (CID 154375641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).