C6H10N2O3 — CID 154375641
methyl 2-oxo-1,3-diazinane-1-carboxylate (PubChem CID 154375641) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is methyl 2-oxo-1,3-diazinane-1-carboxylate.
| Compound Name | methyl 2-oxo-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 154375641 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | methyl 2-oxo-1,3-diazinane-1-carboxylate |
| SMILES | COC(=O)N1CCCNC1=O |
| InChI | InChI=1S/C6H10N2O3/c1-11-6(10)8-4-2-3-7-5(8)9/h2-4H2,1H3,(H,7,9) |
| InChIKey | IEGPPPRGTQMTSG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |