C9H14N2O3 — CID 79897321
methyl 3-(3-oxo-1,4-diazepan-1-yl)prop-2-enoate (PubChem CID 79897321) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 3-(3-oxo-1,4-diazepan-1-yl)prop-2-enoate.
| Compound Name | methyl 3-(3-oxo-1,4-diazepan-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 79897321 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | methyl 3-(3-oxo-1,4-diazepan-1-yl)prop-2-enoate |
| SMILES | COC(=O)C=CN1CCCNC(=O)C1 |
| InChI | InChI=1S/C9H14N2O3/c1-14-9(13)3-6-11-5-2-4-10-8(12)7-11/h3,6H,2,4-5,7H2,1H3,(H,10,12) |
| InChIKey | RQUOMUIXJRBBBL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|