C14H17NO2 — CID 79896178
methyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)prop-2-enoate (PubChem CID 79896178) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is methyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)prop-2-enoate.
| Compound Name | methyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 79896178 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)prop-2-enoate |
| SMILES | COC(=O)C=CN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C14H17NO2/c1-17-14(16)8-10-15-9-4-7-12-5-2-3-6-13(12)11-15/h2-3,5-6,8,10H,4,7,9,11H2,1H3 |
| InChIKey | JDOBDCSWDSINJR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|