C13H17NO2 — CID 63152884
methyl 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetate (PubChem CID 63152884) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetate.
| Compound Name | methyl 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetate |
|---|---|
| PubChem CID | 63152884 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetate |
| SMILES | COC(=O)CN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO2/c1-16-13(15)10-14-8-4-7-11-5-2-3-6-12(11)9-14/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | HWGJVBUBKAJRTH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |