C12H15NO2S — CID 20765990
methyl 2-(6-sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl)acetate (PubChem CID 20765990) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl 2-(6-sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl)acetate.
| Compound Name | methyl 2-(6-sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 20765990 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | methyl 2-(6-sulfanyl-3,4-dihydro-1H-isoquinolin-2-yl)acetate |
| SMILES | COC(=O)CN1CCc2cc(S)ccc2C1 |
| InChI | InChI=1S/C12H15NO2S/c1-15-12(14)8-13-5-4-9-6-11(16)3-2-10(9)7-13/h2-3,6,16H,4-5,7-8H2,1H3 |
| InChIKey | QFLOOMDTSONLNJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|