About methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate
methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate (PubChem CID 172782956) has the molecular formula C16H17ClNO2S+
and a molecular weight of 322.84 g/mol. Its IUPAC name is methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate |
| PubChem CID | 172782956 |
| Molecular Formula | C16H17ClNO2S+ |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate |
| SMILES | COC(=O)CN1CCc2c(cc[s+]2-c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H17ClNO2S/c1-20-16(19)11-18-8-6-14-12(10-18)7-9-21(14)15-5-3-2-4-13(15)17/h2-5,7,9H,6,8,10-11H2,1H3/q+1 |
| InChIKey | OMUSXEITINHGLL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate?
The IUPAC name of methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate (CID 172782956) is methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate.
What is the SMILES notation for methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate?
The canonical SMILES for methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate is COC(=O)CN1CCc2c(cc[s+]2-c2ccccc2Cl)C1.
What is the InChIKey of methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate?
The InChIKey is OMUSXEITINHGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClNO2S/c1-20-16(19)11-18-8-6-14-12(10-18)7-9-21(14)15-5-3-2-4-13(15)17/h2-5,7,9H,6,8,10-11H2,1H3/q+1.
What are the key properties of methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate?
methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate has a molecular weight of 322.84 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(2-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-1-ium-5-yl]acetate is sourced from PubChem (CID 172782956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).