About 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one
1-(5-methylhexan-2-yl)-1,3-diazinan-2-one (PubChem CID 115370924) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one |
| PubChem CID | 115370924 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one |
| SMILES | CC(C)CCC(C)N1CCCNC1=O |
| InChI | InChI=1S/C11H22N2O/c1-9(2)5-6-10(3)13-8-4-7-12-11(13)14/h9-10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | QDUCXPURXGIPHE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one?
The IUPAC name of 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one (CID 115370924) is 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one is CC(C)CCC(C)N1CCCNC1=O.
What is the InChIKey of 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one?
The InChIKey is QDUCXPURXGIPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-9(2)5-6-10(3)13-8-4-7-12-11(13)14/h9-10H,4-8H2,1-3H3,(H,12,14).
What are the key properties of 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one?
1-(5-methylhexan-2-yl)-1,3-diazinan-2-one has a molecular weight of 198.31 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one is sourced from PubChem (CID 115370924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).