C11H22N2O — CID 115370924
1-(5-methylhexan-2-yl)-1,3-diazinan-2-one (PubChem CID 115370924) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115370924 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(5-methylhexan-2-yl)-1,3-diazinan-2-one |
| SMILES | CC(C)CCC(C)N1CCCNC1=O |
| InChI | InChI=1S/C11H22N2O/c1-9(2)5-6-10(3)13-8-4-7-12-11(13)14/h9-10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | QDUCXPURXGIPHE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |