About ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one
ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one (PubChem CID 142006413) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one |
| PubChem CID | 142006413 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one |
| SMILES | CC.CC(=O)C(C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C10H18N2O2.C2H6/c1-7(2)9(8(3)13)12-6-4-5-11-10(12)14;1-2/h7,9H,4-6H2,1-3H3,(H,11,14);1-2H3 |
| InChIKey | AHNDNPRTMCPYNB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one?
The IUPAC name of ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one (CID 142006413) is ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one.
What is the SMILES notation for ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one?
The canonical SMILES for ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one is CC.CC(=O)C(C(C)C)N1CCCNC1=O.
What is the InChIKey of ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one?
The InChIKey is AHNDNPRTMCPYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2.C2H6/c1-7(2)9(8(3)13)12-6-4-5-11-10(12)14;1-2/h7,9H,4-6H2,1-3H3,(H,11,14);1-2H3.
What are the key properties of ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one?
ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one has a molecular weight of 228.34 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one is sourced from PubChem (CID 142006413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).