C12H24N2O2 — CID 142006413
ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one (PubChem CID 142006413) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one.
| Compound Name | ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 142006413 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | ethane;1-(2-methyl-4-oxopentan-3-yl)-1,3-diazinan-2-one |
| SMILES | CC.CC(=O)C(C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C10H18N2O2.C2H6/c1-7(2)9(8(3)13)12-6-4-5-11-10(12)14;1-2/h7,9H,4-6H2,1-3H3,(H,11,14);1-2H3 |
| InChIKey | AHNDNPRTMCPYNB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |