C9H16N2O2 — CID 143176863
3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanal (PubChem CID 143176863) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanal.
| Compound Name | 3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanal |
|---|---|
| PubChem CID | 143176863 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanal |
| SMILES | CC(C)C(C=O)N1CCCNC1=O |
| InChI | InChI=1S/C9H16N2O2/c1-7(2)8(6-12)11-5-3-4-10-9(11)13/h6-8H,3-5H2,1-2H3,(H,10,13) |
| InChIKey | ZMYLIDSECQJKOW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|