C8H17N3O — CID 143382983
1-(1-amino-2-methylpropyl)-1,3-diazinan-2-one (PubChem CID 143382983) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(1-amino-2-methylpropyl)-1,3-diazinan-2-one.
| Compound Name | 1-(1-amino-2-methylpropyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 143382983 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1-(1-amino-2-methylpropyl)-1,3-diazinan-2-one |
| SMILES | CC(C)C(N)N1CCCNC1=O |
| InChI | InChI=1S/C8H17N3O/c1-6(2)7(9)11-5-3-4-10-8(11)12/h6-7H,3-5,9H2,1-2H3,(H,10,12) |
| InChIKey | PDLLJYXNTZSXOQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |