C12H15ClN2O — CID 115371054
1-[1-(3-chlorophenyl)ethyl]-1,3-diazinan-2-one (PubChem CID 115371054) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-1,3-diazinan-2-one.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115371054 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-1,3-diazinan-2-one |
| SMILES | CC(c1cccc(Cl)c1)N1CCCNC1=O |
| InChI | InChI=1S/C12H15ClN2O/c1-9(10-4-2-5-11(13)8-10)15-7-3-6-14-12(15)16/h2,4-5,8-9H,3,6-7H2,1H3,(H,14,16) |
| InChIKey | OITQJEBOLKDQLD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |