2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid

C10H17N3O4 — CID 79936689

IUPAC2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid
SMILESCCCN1CC(=O)N(CC(N)C(=O)O)CC1=O
InChIInChI=1S/C10H17N3O4/c1-2-3-12-5-9(15)13(6-8(12)14)4-7(11)10(16)17/h7H,2-6,11H2,1H3,(H,16,17)
InChIKeyZSGRRLCCUDVUAP-UHFFFAOYSA-N
MW243.26 g/mol
LogP-1.52
Rot. Bonds5

About 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid

2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid (PubChem CID 79936689) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid
PubChem CID79936689
Molecular FormulaC10H17N3O4
Molecular Weight243.26 g/mol
Exact Mass243.12
IUPAC Name2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid
SMILESCCCN1CC(=O)N(CC(N)C(=O)O)CC1=O
InChIInChI=1S/C10H17N3O4/c1-2-3-12-5-9(15)13(6-8(12)14)4-7(11)10(16)17/h7H,2-6,11H2,1H3,(H,16,17)
InChIKeyZSGRRLCCUDVUAP-UHFFFAOYSA-N
XLogP-1.52
TPSA103.94 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.26
LogP ≤ 5-1.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid?
The IUPAC name of 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid (CID 79936689) is 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid is CCCN1CC(=O)N(CC(N)C(=O)O)CC1=O.
What is the InChIKey of 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid?
The InChIKey is ZSGRRLCCUDVUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4/c1-2-3-12-5-9(15)13(6-8(12)14)4-7(11)10(16)17/h7H,2-6,11H2,1H3,(H,16,17).
What are the key properties of 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid?
2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid has a molecular weight of 243.26 g/mol, XLogP of -1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,5-dioxo-4-propylpiperazin-1-yl)propanoic acid is sourced from PubChem (CID 79936689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).