C13H23N3O3 — CID 104747986
1-[2-amino-2-(oxolan-3-yl)ethyl]-4-propylpiperazine-2,5-dione (PubChem CID 104747986) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[2-amino-2-(oxolan-3-yl)ethyl]-4-propylpiperazine-2,5-dione.
| Compound Name | 1-[2-amino-2-(oxolan-3-yl)ethyl]-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 104747986 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-[2-amino-2-(oxolan-3-yl)ethyl]-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(CC(N)C2CCOC2)CC1=O |
| InChI | InChI=1S/C13H23N3O3/c1-2-4-15-7-13(18)16(8-12(15)17)6-11(14)10-3-5-19-9-10/h10-11H,2-9,14H2,1H3 |
| InChIKey | YUKDHQIOTSROLO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |