C24H44N4O4 — CID 146611403
1,4,7,10-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 146611403) has the molecular formula C24H44N4O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | 1,4,7,10-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 146611403 |
| Molecular Formula | C24H44N4O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | 1,4,7,10-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CC(C)CN1CC(=O)N(CC(C)C)CC(=O)N(CC(C)C)CC(=O)N(CC(C)C)CC1=O |
| InChI | InChI=1S/C24H44N4O4/c1-17(2)9-25-13-22(30)27(11-19(5)6)15-24(32)28(12-20(7)8)16-23(31)26(10-18(3)4)14-21(25)29/h17-20H,9-16H2,1-8H3 |
| InChIKey | SJRNMWOBZSTBNL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |