C11H19ClN2O2 — CID 79937288
1-(5-chloropentyl)-4-ethylpiperazine-2,5-dione (PubChem CID 79937288) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 1-(5-chloropentyl)-4-ethylpiperazine-2,5-dione.
| Compound Name | 1-(5-chloropentyl)-4-ethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79937288 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-(5-chloropentyl)-4-ethylpiperazine-2,5-dione |
| SMILES | CCN1CC(=O)N(CCCCCCl)CC1=O |
| InChI | InChI=1S/C11H19ClN2O2/c1-2-13-8-11(16)14(9-10(13)15)7-5-3-4-6-12/h2-9H2,1H3 |
| InChIKey | XJYXFSGLMNMHJO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|