C10H18N2O3 — CID 115825071
1-(5-hydroxypentyl)-4-methylpiperazine-2,5-dione (PubChem CID 115825071) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)-4-methylpiperazine-2,5-dione.
| Compound Name | 1-(5-hydroxypentyl)-4-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 115825071 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-(5-hydroxypentyl)-4-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(CCCCCO)CC1=O |
| InChI | InChI=1S/C10H18N2O3/c1-11-7-10(15)12(8-9(11)14)5-3-2-4-6-13/h13H,2-8H2,1H3 |
| InChIKey | MDIBSMKNMUNRKN-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|