C15H17FN2O3 — CID 79937414
1-[4-(4-fluorophenyl)-4-oxobutyl]-4-methylpiperazine-2,5-dione (PubChem CID 79937414) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-4-oxobutyl]-4-methylpiperazine-2,5-dione.
| Compound Name | 1-[4-(4-fluorophenyl)-4-oxobutyl]-4-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79937414 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-4-oxobutyl]-4-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(CCCC(=O)c2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C15H17FN2O3/c1-17-9-15(21)18(10-14(17)20)8-2-3-13(19)11-4-6-12(16)7-5-11/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | QWLQFUOEVLFYFW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |