C21H22F2O2 — CID 68637188
1,9-bis(4-fluorophenyl)nonane-1,9-dione (PubChem CID 68637188) has the molecular formula C21H22F2O2 and a molecular weight of 344.40 g/mol. Its IUPAC name is 1,9-bis(4-fluorophenyl)nonane-1,9-dione.
| Compound Name | 1,9-bis(4-fluorophenyl)nonane-1,9-dione |
|---|---|
| PubChem CID | 68637188 |
| Molecular Formula | C21H22F2O2 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1,9-bis(4-fluorophenyl)nonane-1,9-dione |
| SMILES | O=C(CCCCCCCC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22F2O2/c22-18-12-8-16(9-13-18)20(24)6-4-2-1-3-5-7-21(25)17-10-14-19(23)15-11-17/h8-15H,1-7H2 |
| InChIKey | VTCSITOBXRSTAT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|