C23H28FNO4 — CID 58536953
9-[4-[1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]-N-hydroxy-9-oxononanamide (PubChem CID 58536953) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is 9-[4-[1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]-N-hydroxy-9-oxononanamide.
| Compound Name | 9-[4-[1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]-N-hydroxy-9-oxononanamide |
|---|---|
| PubChem CID | 58536953 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 9-[4-[1-(4-fluorophenyl)-1-hydroxyethyl]phenyl]-N-hydroxy-9-oxononanamide |
| SMILES | CC(O)(c1ccc(F)cc1)c1ccc(C(=O)CCCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C23H28FNO4/c1-23(28,19-13-15-20(24)16-14-19)18-11-9-17(10-12-18)21(26)7-5-3-2-4-6-8-22(27)25-29/h9-16,28-29H,2-8H2,1H3,(H,25,27) |
| InChIKey | ZJGSFSOUUZATJH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|