C23H28FNO3 — CID 110308987
4-(4-tert-butylphenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide (PubChem CID 110308987) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide.
| Compound Name | 4-(4-tert-butylphenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110308987 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-(4-tert-butylphenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide |
| SMILES | CC(C)(C)c1ccc(C(=O)CCC(=O)NCC(C)(O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H28FNO3/c1-22(2,3)17-7-5-16(6-8-17)20(26)13-14-21(27)25-15-23(4,28)18-9-11-19(24)12-10-18/h5-12,28H,13-15H2,1-4H3,(H,25,27) |
| InChIKey | GSFLUDOFODKOIQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |