C19H19F2NO3 — CID 71683994
4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide (PubChem CID 71683994) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 71683994 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxypropyl]-4-oxobutanamide |
| SMILES | CC(O)(CNC(=O)CCC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2NO3/c1-19(25,14-4-8-16(21)9-5-14)12-22-18(24)11-10-17(23)13-2-6-15(20)7-3-13/h2-9,25H,10-12H2,1H3,(H,22,24) |
| InChIKey | XCLDAZDPQVMWTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |