C30H33F2NO4 — CID 58537022
9-[4-[bis(4-fluoro-2-methylphenyl)-hydroxymethyl]phenyl]-N-hydroxy-9-oxononanamide (PubChem CID 58537022) has the molecular formula C30H33F2NO4 and a molecular weight of 509.59 g/mol. Its IUPAC name is 9-[4-[bis(4-fluoro-2-methylphenyl)-hydroxymethyl]phenyl]-N-hydroxy-9-oxononanamide.
| Compound Name | 9-[4-[bis(4-fluoro-2-methylphenyl)-hydroxymethyl]phenyl]-N-hydroxy-9-oxononanamide |
|---|---|
| PubChem CID | 58537022 |
| Molecular Formula | C30H33F2NO4 |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 9-[4-[bis(4-fluoro-2-methylphenyl)-hydroxymethyl]phenyl]-N-hydroxy-9-oxononanamide |
| SMILES | Cc1cc(F)ccc1C(O)(c1ccc(C(=O)CCCCCCCC(=O)NO)cc1)c1ccc(F)cc1C |
| InChI | InChI=1S/C30H33F2NO4/c1-20-18-24(31)14-16-26(20)30(36,27-17-15-25(32)19-21(27)2)23-12-10-22(11-13-23)28(34)8-6-4-3-5-7-9-29(35)33-37/h10-19,36-37H,3-9H2,1-2H3,(H,33,35) |
| InChIKey | JLIISHSKQBUCIT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|