C20H22F2N2O2 — CID 141456349
2,2-diamino-1,8-bis(4-fluorophenyl)octane-1,8-dione (PubChem CID 141456349) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 2,2-diamino-1,8-bis(4-fluorophenyl)octane-1,8-dione.
| Compound Name | 2,2-diamino-1,8-bis(4-fluorophenyl)octane-1,8-dione |
|---|---|
| PubChem CID | 141456349 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2,2-diamino-1,8-bis(4-fluorophenyl)octane-1,8-dione |
| SMILES | NC(N)(CCCCCC(=O)c1ccc(F)cc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22F2N2O2/c21-16-9-5-14(6-10-16)18(25)4-2-1-3-13-20(23,24)19(26)15-7-11-17(22)12-8-15/h5-12H,1-4,13,23-24H2 |
| InChIKey | VPDOCRUUDABMEX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|