C15H23N3O3 — CID 142402457
2,2-diamino-1-(4-nitrophenyl)nonan-1-one (PubChem CID 142402457) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2,2-diamino-1-(4-nitrophenyl)nonan-1-one.
| Compound Name | 2,2-diamino-1-(4-nitrophenyl)nonan-1-one |
|---|---|
| PubChem CID | 142402457 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2,2-diamino-1-(4-nitrophenyl)nonan-1-one |
| SMILES | CCCCCCCC(N)(N)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H23N3O3/c1-2-3-4-5-6-11-15(16,17)14(19)12-7-9-13(10-8-12)18(20)21/h7-10H,2-6,11,16-17H2,1H3 |
| InChIKey | OPGWWUDDBZTTOJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|