C23H28O2S2 — CID 18183648
1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione (PubChem CID 18183648) has the molecular formula C23H28O2S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione.
| Compound Name | 1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione |
|---|---|
| PubChem CID | 18183648 |
| Molecular Formula | C23H28O2S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione |
| SMILES | CSc1ccc(C(=O)CCCCCCCC(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C23H28O2S2/c1-26-20-14-10-18(11-15-20)22(24)8-6-4-3-5-7-9-23(25)19-12-16-21(27-2)17-13-19/h10-17H,3-9H2,1-2H3 |
| InChIKey | OSGJXRQDEZSVBT-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|