C30H36O2S3 — CID 161175426
1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione;methylsulfanylbenzene (PubChem CID 161175426) has the molecular formula C30H36O2S3 and a molecular weight of 524.82 g/mol. Its IUPAC name is 1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione;methylsulfanylbenzene.
| Compound Name | 1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione;methylsulfanylbenzene |
|---|---|
| PubChem CID | 161175426 |
| Molecular Formula | C30H36O2S3 |
| Molecular Weight | 524.82 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 1,9-bis(4-methylsulfanylphenyl)nonane-1,9-dione;methylsulfanylbenzene |
| SMILES | CSc1ccc(C(=O)CCCCCCCC(=O)c2ccc(SC)cc2)cc1.CSc1ccccc1 |
| InChI | InChI=1S/C23H28O2S2.C7H8S/c1-26-20-14-10-18(11-15-20)22(24)8-6-4-3-5-7-9-23(25)19-12-16-21(27-2)17-13-19;1-8-7-5-3-2-4-6-7/h10-17H,3-9H2,1-2H3;2-6H,1H3 |
| InChIKey | URSVMBWTZNZXKE-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.82 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|