About N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide
N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide (PubChem CID 44759171) has the molecular formula C18H20N2O2S
and a molecular weight of 328.44 g/mol. Its IUPAC name is N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide.
Molecular Properties
| Compound Name | N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide |
| PubChem CID | 44759171 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide |
| SMILES | CSc1ccc(C(=O)CCC(=O)NN(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N2O2S/c1-20(15-6-4-3-5-7-15)19-18(22)13-12-17(21)14-8-10-16(23-2)11-9-14/h3-11H,12-13H2,1-2H3,(H,19,22) |
| InChIKey | NRTJZMJMKKUEJW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide?
The IUPAC name of N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide (CID 44759171) is N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide.
What is the SMILES notation for N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide?
The canonical SMILES for N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide is CSc1ccc(C(=O)CCC(=O)NN(C)c2ccccc2)cc1.
What is the InChIKey of N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide?
The InChIKey is NRTJZMJMKKUEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2S/c1-20(15-6-4-3-5-7-15)19-18(22)13-12-17(21)14-8-10-16(23-2)11-9-14/h3-11H,12-13H2,1-2H3,(H,19,22).
What are the key properties of N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide?
N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide has a molecular weight of 328.44 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-4-(4-methylsulfanylphenyl)-4-oxo-N'-phenylbutanehydrazide is sourced from PubChem (CID 44759171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).