About N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide
N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide (PubChem CID 9479963) has the molecular formula C16H18N2OS
and a molecular weight of 286.40 g/mol. Its IUPAC name is N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide |
| PubChem CID | 9479963 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide |
| SMILES | CSCc1ccc(C(=O)NN(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2OS/c1-18(15-6-4-3-5-7-15)17-16(19)14-10-8-13(9-11-14)12-20-2/h3-11H,12H2,1-2H3,(H,17,19) |
| InChIKey | IYVDHKXPSMTXHC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide?
The IUPAC name of N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide (CID 9479963) is N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide.
What is the SMILES notation for N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide?
The canonical SMILES for N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide is CSCc1ccc(C(=O)NN(C)c2ccccc2)cc1.
What is the InChIKey of N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide?
The InChIKey is IYVDHKXPSMTXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2OS/c1-18(15-6-4-3-5-7-15)17-16(19)14-10-8-13(9-11-14)12-20-2/h3-11H,12H2,1-2H3,(H,17,19).
What are the key properties of N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide?
N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide has a molecular weight of 286.40 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-4-(methylsulfanylmethyl)-N'-phenylbenzohydrazide is sourced from PubChem (CID 9479963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).