C14H12F2N2O — CID 9479852
3,5-difluoro-N'-methyl-N'-phenylbenzohydrazide (PubChem CID 9479852) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is 3,5-difluoro-N'-methyl-N'-phenylbenzohydrazide.
| Compound Name | 3,5-difluoro-N'-methyl-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 9479852 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3,5-difluoro-N'-methyl-N'-phenylbenzohydrazide |
| SMILES | CN(NC(=O)c1cc(F)cc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H12F2N2O/c1-18(13-5-3-2-4-6-13)17-14(19)10-7-11(15)9-12(16)8-10/h2-9H,1H3,(H,17,19) |
| InChIKey | MNBDJHSNUOLAFE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|