About 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide
4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide (PubChem CID 17432301) has the molecular formula C15H15N3O4
and a molecular weight of 301.30 g/mol. Its IUPAC name is 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide |
| PubChem CID | 17432301 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide |
| SMILES | COc1ccc(C(=O)NN(C)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O4/c1-17(12-6-4-3-5-7-12)16-15(19)11-8-9-14(22-2)13(10-11)18(20)21/h3-10H,1-2H3,(H,16,19) |
| InChIKey | RGHRENHILWGRKV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide?
The IUPAC name of 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide (CID 17432301) is 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide.
What is the SMILES notation for 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide?
The canonical SMILES for 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide is COc1ccc(C(=O)NN(C)c2ccccc2)cc1[N+](=O)[O-].
What is the InChIKey of 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide?
The InChIKey is RGHRENHILWGRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4/c1-17(12-6-4-3-5-7-12)16-15(19)11-8-9-14(22-2)13(10-11)18(20)21/h3-10H,1-2H3,(H,16,19).
What are the key properties of 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide?
4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide has a molecular weight of 301.30 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N'-methyl-3-nitro-N'-phenylbenzohydrazide is sourced from PubChem (CID 17432301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).