C19H21N3O2 — CID 18121150
N'-methyl-4-(2-oxopiperidin-1-yl)-N'-phenylbenzohydrazide (PubChem CID 18121150) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N'-methyl-4-(2-oxopiperidin-1-yl)-N'-phenylbenzohydrazide.
| Compound Name | N'-methyl-4-(2-oxopiperidin-1-yl)-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 18121150 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N'-methyl-4-(2-oxopiperidin-1-yl)-N'-phenylbenzohydrazide |
| SMILES | CN(NC(=O)c1ccc(N2CCCCC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2/c1-21(16-7-3-2-4-8-16)20-19(24)15-10-12-17(13-11-15)22-14-6-5-9-18(22)23/h2-4,7-8,10-13H,5-6,9,14H2,1H3,(H,20,24) |
| InChIKey | XXBKNRJVNPWGLL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|