C14H17FN2O2 — CID 102889587
4-[2-(4-fluorophenyl)-2-oxoethyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102889587) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-2-oxoethyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[2-(4-fluorophenyl)-2-oxoethyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889587 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-2-oxoethyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(CC(=O)c2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C14H17FN2O2/c1-16-7-2-8-17(10-14(16)19)9-13(18)11-3-5-12(15)6-4-11/h3-6H,2,7-10H2,1H3 |
| InChIKey | UJFLKKAUFWFPHI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |