C8H14N2O3 — CID 102889426
2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid (PubChem CID 102889426) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid.
| Compound Name | 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid |
|---|---|
| PubChem CID | 102889426 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid |
| SMILES | CN1CCCN(CC(=O)O)CC1=O |
| InChI | InChI=1S/C8H14N2O3/c1-9-3-2-4-10(5-7(9)11)6-8(12)13/h2-6H2,1H3,(H,12,13) |
| InChIKey | DQLYFTMWMGHKQB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |