2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid

C8H14N2O3 — CID 102889426

IUPAC2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid
SMILESCN1CCCN(CC(=O)O)CC1=O
InChIInChI=1S/C8H14N2O3/c1-9-3-2-4-10(5-7(9)11)6-8(12)13/h2-6H2,1H3,(H,12,13)
InChIKeyDQLYFTMWMGHKQB-UHFFFAOYSA-N
MW186.21 g/mol
LogP-0.76
Rot. Bonds2

About 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid

2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid (PubChem CID 102889426) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid
PubChem CID102889426
Molecular FormulaC8H14N2O3
Molecular Weight186.21 g/mol
Exact Mass186.10
IUPAC Name2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid
SMILESCN1CCCN(CC(=O)O)CC1=O
InChIInChI=1S/C8H14N2O3/c1-9-3-2-4-10(5-7(9)11)6-8(12)13/h2-6H2,1H3,(H,12,13)
InChIKeyDQLYFTMWMGHKQB-UHFFFAOYSA-N
XLogP-0.76
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 5-0.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid?
The IUPAC name of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid (CID 102889426) is 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid.
What is the SMILES notation for 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid?
The canonical SMILES for 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid is CN1CCCN(CC(=O)O)CC1=O.
What is the InChIKey of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid?
The InChIKey is DQLYFTMWMGHKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-9-3-2-4-10(5-7(9)11)6-8(12)13/h2-6H2,1H3,(H,12,13).
What are the key properties of 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid?
2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid has a molecular weight of 186.21 g/mol, XLogP of -0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-3-oxo-1,4-diazepan-1-yl)acetic acid is sourced from PubChem (CID 102889426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).