C12H22N2O2 — CID 102889650
1-methyl-4-(5-oxohexyl)-1,4-diazepan-2-one (PubChem CID 102889650) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-methyl-4-(5-oxohexyl)-1,4-diazepan-2-one.
| Compound Name | 1-methyl-4-(5-oxohexyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889650 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-methyl-4-(5-oxohexyl)-1,4-diazepan-2-one |
| SMILES | CC(=O)CCCCN1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-11(15)6-3-4-8-14-9-5-7-13(2)12(16)10-14/h3-10H2,1-2H3 |
| InChIKey | XVGNHNAXTWXCFQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|