C12H22N2O2 — CID 102889641
4-(3,3-dimethyl-2-oxobutyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102889641) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-oxobutyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(3,3-dimethyl-2-oxobutyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889641 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-(3,3-dimethyl-2-oxobutyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(CC(=O)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C12H22N2O2/c1-12(2,3)10(15)8-14-7-5-6-13(4)11(16)9-14/h5-9H2,1-4H3 |
| InChIKey | WSXXQSFXLFNRFB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |