C9H17IN2O — CID 126986118
4-(3-iodopropyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 126986118) has the molecular formula C9H17IN2O and a molecular weight of 296.15 g/mol. Its IUPAC name is 4-(3-iodopropyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(3-iodopropyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 126986118 |
| Molecular Formula | C9H17IN2O |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-(3-iodopropyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(CCCI)CC1=O |
| InChI | InChI=1S/C9H17IN2O/c1-11-5-3-7-12(6-2-4-10)8-9(11)13/h2-8H2,1H3 |
| InChIKey | REWOKCVDLLVGPZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|