C12H17N3O — CID 117005343
1-methyl-4-(pyridin-4-ylmethyl)-1,4-diazepan-2-one (PubChem CID 117005343) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-methyl-4-(pyridin-4-ylmethyl)-1,4-diazepan-2-one.
| Compound Name | 1-methyl-4-(pyridin-4-ylmethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 117005343 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-methyl-4-(pyridin-4-ylmethyl)-1,4-diazepan-2-one |
| SMILES | CN1CCCN(Cc2ccncc2)CC1=O |
| InChI | InChI=1S/C12H17N3O/c1-14-7-2-8-15(10-12(14)16)9-11-3-5-13-6-4-11/h3-6H,2,7-10H2,1H3 |
| InChIKey | FHDODLOCZKOQLO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |